C18H23N5O2 — CID 99636299
2-[(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]-2-oxo-N-pyridin-3-ylacetamide (PubChem CID 99636299) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]-2-oxo-N-pyridin-3-ylacetamide.
| Compound Name | 2-[(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]-2-oxo-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 99636299 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]-2-oxo-N-pyridin-3-ylacetamide |
| SMILES | Cc1n[nH]c(C)c1[C@@H]1CCCCCN1C(=O)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C18H23N5O2/c1-12-16(13(2)22-21-12)15-8-4-3-5-10-23(15)18(25)17(24)20-14-7-6-9-19-11-14/h6-7,9,11,15H,3-5,8,10H2,1-2H3,(H,20,24)(H,21,22)/t15-/m0/s1 |
| InChIKey | JJYXUJIRUJDFGC-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|