About methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate
methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate (PubChem CID 99636403) has the molecular formula C11H21NO4S2
and a molecular weight of 295.43 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate.
Molecular Properties
| Compound Name | methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate |
| PubChem CID | 99636403 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N1CCS[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H21NO4S2/c1-9-10(2)17-7-6-12(9)18(14,15)8-4-5-11(13)16-3/h9-10H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | WRVPFBSDZSDSGG-UWVGGRQHSA-N |
| XLogP | 1.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate?
The IUPAC name of methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate (CID 99636403) is methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate.
What is the SMILES notation for methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate?
The canonical SMILES for methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate is COC(=O)CCCS(=O)(=O)N1CCS[C@@H](C)[C@@H]1C.
What is the InChIKey of methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate?
The InChIKey is WRVPFBSDZSDSGG-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H21NO4S2/c1-9-10(2)17-7-6-12(9)18(14,15)8-4-5-11(13)16-3/h9-10H,4-8H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate?
methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate has a molecular weight of 295.43 g/mol, XLogP of 1.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S,3S)-2,3-dimethylthiomorpholin-4-yl]sulfonylbutanoate is sourced from PubChem (CID 99636403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).