C11H21NOS — CID 99636838
(3S)-3-[[[(2R)-hex-5-en-2-yl]amino]methyl]thiolan-3-ol (PubChem CID 99636838) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is (3S)-3-[[[(2R)-hex-5-en-2-yl]amino]methyl]thiolan-3-ol.
| Compound Name | (3S)-3-[[[(2R)-hex-5-en-2-yl]amino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 99636838 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (3S)-3-[[[(2R)-hex-5-en-2-yl]amino]methyl]thiolan-3-ol |
| SMILES | C=CCC[C@@H](C)NC[C@@]1(O)CCSC1 |
| InChI | InChI=1S/C11H21NOS/c1-3-4-5-10(2)12-8-11(13)6-7-14-9-11/h3,10,12-13H,1,4-9H2,2H3/t10-,11+/m1/s1 |
| InChIKey | UMKPMUDXHLRZBP-MNOVXSKESA-N |
| XLogP | 1.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|