C16H15N3OS2 — CID 99643868
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]acetamide (PubChem CID 99643868) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 99643868 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C1\C[C@@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C16H15N3OS2/c20-15(19-18-13-8-10-4-3-5-11(10)13)9-21-16-17-12-6-1-2-7-14(12)22-16/h1-4,6-7,10-11H,5,8-9H2,(H,19,20)/b18-13+/t10-,11+/m0/s1 |
| InChIKey | WXDJVUBAJRYXDR-WNYFIRAASA-N |
| XLogP | 3.46 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|