C13H14O2 — CID 99644725
(3S,4S,5E,11E)-trideca-1,5,11-trien-7,9-diyne-3,4-diol (PubChem CID 99644725) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3S,4S,5E,11E)-trideca-1,5,11-trien-7,9-diyne-3,4-diol.
| Compound Name | (3S,4S,5E,11E)-trideca-1,5,11-trien-7,9-diyne-3,4-diol |
|---|---|
| PubChem CID | 99644725 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3S,4S,5E,11E)-trideca-1,5,11-trien-7,9-diyne-3,4-diol |
| SMILES | C=C[C@H](O)[C@@H](O)/C=C/C#CC#C/C=C/C |
| InChI | InChI=1S/C13H14O2/c1-3-5-6-7-8-9-10-11-13(15)12(14)4-2/h3-5,10-15H,2H2,1H3/b5-3+,11-10+/t12-,13-/m0/s1 |
| InChIKey | JBNSKDKKTWMOEL-SFXSTHPXSA-N |
| XLogP | 1.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|