C46H34N4O2 — CID 99648033
methyl 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzoate (PubChem CID 99648033) has the molecular formula C46H34N4O2 and a molecular weight of 674.80 g/mol. Its IUPAC name is methyl 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzoate.
| Compound Name | methyl 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzoate |
|---|---|
| PubChem CID | 99648033 |
| Molecular Formula | C46H34N4O2 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | methyl 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C46H34N4O2/c1-52-46(51)33-19-17-32(18-20-33)45-40-27-25-38(49-40)43(30-13-7-3-8-14-30)36-23-21-34(47-36)42(29-11-5-2-6-12-29)35-22-24-37(48-35)44(31-15-9-4-10-16-31)39-26-28-41(45)50-39/h2-28,47-50H,1H3 |
| InChIKey | IBVUGZHADOIQDP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |