C37H35N3O7 — CID 99650389
N-[1-[(2R,4S,5S)-4-hydroxy-5-[(1S)-1-methoxy-1-methylperoxy-2,2,2-triphenylethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 99650389) has the molecular formula C37H35N3O7 and a molecular weight of 633.70 g/mol. Its IUPAC name is N-[1-[(2R,4S,5S)-4-hydroxy-5-[(1S)-1-methoxy-1-methylperoxy-2,2,2-triphenylethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5S)-4-hydroxy-5-[(1S)-1-methoxy-1-methylperoxy-2,2,2-triphenylethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 99650389 |
| Molecular Formula | C37H35N3O7 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | N-[1-[(2R,4S,5S)-4-hydroxy-5-[(1S)-1-methoxy-1-methylperoxy-2,2,2-triphenylethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COO[C@](OC)([C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C[C@@H]1O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H35N3O7/c1-44-37(47-45-2,36(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29)33-30(41)25-32(46-33)40-24-23-31(39-35(40)43)38-34(42)26-15-7-3-8-16-26/h3-24,30,32-33,41H,25H2,1-2H3,(H,38,39,42,43)/t30-,32+,33-,37+/m0/s1 |
| InChIKey | ZNRWTKPHNVKIJB-XOGYCULLSA-N |
| XLogP | 5.10 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|