C36H44N2O9 — CID 99652960
(3R)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 99652960) has the molecular formula C36H44N2O9 and a molecular weight of 648.75 g/mol. Its IUPAC name is (3R)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3R)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 99652960 |
| Molecular Formula | C36H44N2O9 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | (3R)-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COc1ccc(CCN(C(=O)[C@H]2COc3ccccc3O2)[C@@H](C(=O)NC2CCCCC2)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C36H44N2O9/c1-41-26-16-15-23(19-29(26)42-2)17-18-38(36(40)32-22-46-27-13-9-10-14-28(27)47-32)33(35(39)37-25-11-7-6-8-12-25)24-20-30(43-3)34(45-5)31(21-24)44-4/h9-10,13-16,19-21,25,32-33H,6-8,11-12,17-18,22H2,1-5H3,(H,37,39)/t32-,33-/m1/s1 |
| InChIKey | QEKXGPAMHUVYRI-CZNDPXEESA-N |
| XLogP | 5.13 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |