C27H19ClF5N3O5S — CID 99653378
(6R)-3-(1,3-benzodioxol-5-ylmethyl)-N-[4-[chloro(difluoro)methoxy]phenyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 99653378) has the molecular formula C27H19ClF5N3O5S and a molecular weight of 627.98 g/mol. Its IUPAC name is (6R)-3-(1,3-benzodioxol-5-ylmethyl)-N-[4-[chloro(difluoro)methoxy]phenyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-3-(1,3-benzodioxol-5-ylmethyl)-N-[4-[chloro(difluoro)methoxy]phenyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 99653378 |
| Molecular Formula | C27H19ClF5N3O5S |
| Molecular Weight | 627.98 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | (6R)-3-(1,3-benzodioxol-5-ylmethyl)-N-[4-[chloro(difluoro)methoxy]phenyl]-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)[C@H]1CC(=O)N(Cc2ccc3c(c2)OCO3)/C(=N/c2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C27H19ClF5N3O5S/c28-27(32,33)41-19-7-5-17(6-8-19)34-24(38)22-12-23(37)36(13-15-4-9-20-21(10-15)40-14-39-20)25(42-22)35-18-3-1-2-16(11-18)26(29,30)31/h1-11,22H,12-14H2,(H,34,38)/b35-25-/t22-/m1/s1 |
| InChIKey | VWGMLXIISITXRS-DPGSGBJOSA-N |
| XLogP | 6.76 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.98 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|