C28H29ClN6O6S2 — CID 99683115
[(3S)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-[1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-propan-2-ylpyrazol-4-yl]methanone (PubChem CID 99683115) has the molecular formula C28H29ClN6O6S2 and a molecular weight of 645.16 g/mol. Its IUPAC name is [(3S)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-[1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-propan-2-ylpyrazol-4-yl]methanone.
| Compound Name | [(3S)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-[1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-propan-2-ylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 99683115 |
| Molecular Formula | C28H29ClN6O6S2 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.13 |
| IUPAC Name | [(3S)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-[1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-propan-2-ylpyrazol-4-yl]methanone |
| SMILES | COc1cccc(-c2csc(-n3ncc(C(=O)N4CCN(S(=O)(=O)c5ccc(Cl)c([N+](=O)[O-])c5)[C@@H](C)C4)c3C(C)C)n2)c1 |
| InChI | InChI=1S/C28H29ClN6O6S2/c1-17(2)26-22(14-30-34(26)28-31-24(16-42-28)19-6-5-7-20(12-19)41-4)27(36)32-10-11-33(18(3)15-32)43(39,40)21-8-9-23(29)25(13-21)35(37)38/h5-9,12-14,16-18H,10-11,15H2,1-4H3/t18-/m0/s1 |
| InChIKey | MIBSUGSKCORJBK-SFHVURJKSA-N |
| XLogP | 5.22 |
| TPSA | 140.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|