C38H44N4O9 — CID 99693699
N-[(7S)-10-[[4-[4-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-4-oxobutyl]amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 99693699) has the molecular formula C38H44N4O9 and a molecular weight of 700.79 g/mol. Its IUPAC name is N-[(7S)-10-[[4-[4-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-4-oxobutyl]amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S)-10-[[4-[4-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-4-oxobutyl]amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 99693699 |
| Molecular Formula | C38H44N4O9 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | N-[(7S)-10-[[4-[4-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-4-oxobutyl]amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)N3CCN(C(=O)[C@H]4COc5ccccc5O4)CC3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C38H44N4O9/c1-23(43)40-27-13-11-24-20-32(47-2)36(48-3)37(49-4)35(24)25-12-14-28(29(44)21-26(25)27)39-15-7-10-34(45)41-16-18-42(19-17-41)38(46)33-22-50-30-8-5-6-9-31(30)51-33/h5-6,8-9,12,14,20-21,27,33H,7,10-11,13,15-19,22H2,1-4H3,(H,39,44)(H,40,43)/t27-,33+/m0/s1 |
| InChIKey | CEHCYBDPJUBIFE-VCTRWQRLSA-N |
| XLogP | 3.57 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|