C14H16N2O4S — CID 99698759
[(2R,5R)-2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)methanone (PubChem CID 99698759) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is [(2R,5R)-2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)methanone.
| Compound Name | [(2R,5R)-2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)methanone |
|---|---|
| PubChem CID | 99698759 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [(2R,5R)-2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)methanone |
| SMILES | C[C@@H]1CO[C@@H](CO)CN1C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-8-7-19-10(6-17)5-16(8)13(18)9-2-3-11-12(4-9)20-14(21)15-11/h2-4,8,10,17H,5-7H2,1H3,(H,15,21)/t8-,10-/m1/s1 |
| InChIKey | UTJHFWWWOKXLDB-PSASIEDQSA-N |
| XLogP | 1.71 |
| TPSA | 78.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|