C12H7N3S — CID 99713917
1-(1,3-benzothiazol-2-yl)pyrrole-2-carbonitrile (PubChem CID 99713917) has the molecular formula C12H7N3S and a molecular weight of 225.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)pyrrole-2-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-yl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 99713917 |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H7N3S/c13-8-9-4-3-7-15(9)12-14-10-5-1-2-6-11(10)16-12/h1-7H |
| InChIKey | RXNDDIIMQHYOOP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |