C11H19NO — CID 99715134
(1-butyl-2,5-dimethylpyrrol-3-yl)methanol (PubChem CID 99715134) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (1-butyl-2,5-dimethylpyrrol-3-yl)methanol.
| Compound Name | (1-butyl-2,5-dimethylpyrrol-3-yl)methanol |
|---|---|
| PubChem CID | 99715134 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1-butyl-2,5-dimethylpyrrol-3-yl)methanol |
| SMILES | CCCCn1c(C)cc(CO)c1C |
| InChI | InChI=1S/C11H19NO/c1-4-5-6-12-9(2)7-11(8-13)10(12)3/h7,13H,4-6,8H2,1-3H3 |
| InChIKey | XBFJHWQXSDJTHD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |