C14H12N4O2S — CID 99718669
5-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]amino]-2-nitrobenzonitrile (PubChem CID 99718669) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 5-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]amino]-2-nitrobenzonitrile.
| Compound Name | 5-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]amino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 99718669 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]amino]-2-nitrobenzonitrile |
| SMILES | N#Cc1cc(N[C@H](c2nccs2)C2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O2S/c15-8-10-7-11(3-4-12(10)18(19)20)17-13(9-1-2-9)14-16-5-6-21-14/h3-7,9,13,17H,1-2H2/t13-/m0/s1 |
| InChIKey | PVVHDYXMYPSMOC-ZDUSSCGKSA-N |
| XLogP | 3.49 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|