C12H19BO3 — CID 99738323
(3-hydroxy-2,2-dimethylpropoxy)-(4-methylphenyl)borinic acid (PubChem CID 99738323) has the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylpropoxy)-(4-methylphenyl)borinic acid.
| Compound Name | (3-hydroxy-2,2-dimethylpropoxy)-(4-methylphenyl)borinic acid |
|---|---|
| PubChem CID | 99738323 |
| Molecular Formula | C12H19BO3 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3-hydroxy-2,2-dimethylpropoxy)-(4-methylphenyl)borinic acid |
| SMILES | Cc1ccc(B(O)OCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C12H19BO3/c1-10-4-6-11(7-5-10)13(15)16-9-12(2,3)8-14/h4-7,14-15H,8-9H2,1-3H3 |
| InChIKey | QQYQYPGPNKVDKQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|