C23H23N5O3 — CID 99744219
(6R)-6-(2,4-dimethylphenyl)-3-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 99744219) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is (6R)-6-(2,4-dimethylphenyl)-3-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | (6R)-6-(2,4-dimethylphenyl)-3-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 99744219 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (6R)-6-(2,4-dimethylphenyl)-3-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | CCOc1ccccc1-c1noc(-c2nnn3c2CO[C@H](c2ccc(C)cc2C)C3)n1 |
| InChI | InChI=1S/C23H23N5O3/c1-4-29-19-8-6-5-7-17(19)22-24-23(31-26-22)21-18-13-30-20(12-28(18)27-25-21)16-10-9-14(2)11-15(16)3/h5-11,20H,4,12-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | TXCGNKAYPILSHN-FQEVSTJZSA-N |
| XLogP | 4.28 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |