C21H18ClN5O2 — CID 99744228
(6R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(2,4-dimethylphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 99744228) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is (6R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(2,4-dimethylphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | (6R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(2,4-dimethylphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 99744228 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (6R)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(2,4-dimethylphenyl)-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | Cc1ccc([C@@H]2Cn3nnc(-c4nc(-c5cccc(Cl)c5)no4)c3CO2)c(C)c1 |
| InChI | InChI=1S/C21H18ClN5O2/c1-12-6-7-16(13(2)8-12)18-10-27-17(11-28-18)19(24-26-27)21-23-20(25-29-21)14-4-3-5-15(22)9-14/h3-9,18H,10-11H2,1-2H3/t18-/m0/s1 |
| InChIKey | YXKBABRZOIYZBT-SFHVURJKSA-N |
| XLogP | 4.54 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |