C38H48N4O5 — CID 99748392
(1R,2R,5S,6S,7R)-3-[3-(4-benzylpiperidin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99748392) has the molecular formula C38H48N4O5 and a molecular weight of 640.83 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R)-3-[3-(4-benzylpiperidin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6S,7R)-3-[3-(4-benzylpiperidin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99748392 |
| Molecular Formula | C38H48N4O5 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.36 |
| IUPAC Name | (1R,2R,5S,6S,7R)-3-[3-(4-benzylpiperidin-1-yl)propyl]-2-N-cyclohexyl-6-N-(3-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)[C@@H]2[C@H]3C=C[C@]4(O3)[C@H](C(=O)NC3CCCCC3)N(CCCN3CCC(Cc5ccccc5)CC3)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C38H48N4O5/c1-46-30-15-8-14-29(25-30)40-35(43)32-31-16-19-38(47-31)33(32)37(45)42(34(38)36(44)39-28-12-6-3-7-13-28)21-9-20-41-22-17-27(18-23-41)24-26-10-4-2-5-11-26/h2,4-5,8,10-11,14-16,19,25,27-28,31-34H,3,6-7,9,12-13,17-18,20-24H2,1H3,(H,39,44)(H,40,43)/t31-,32-,33-,34+,38-/m1/s1 |
| InChIKey | ZXKYDHWHIZFSEY-MFJQCWQNSA-N |
| XLogP | 4.58 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|