C33H38ClN3O5 — CID 99750539
(1S,2R,5R,6S,7S)-6-N-(4-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99750539) has the molecular formula C33H38ClN3O5 and a molecular weight of 592.14 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-6-N-(4-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-6-N-(4-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99750539 |
| Molecular Formula | C33H38ClN3O5 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (1S,2R,5R,6S,7S)-6-N-(4-chlorophenyl)-2-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCOc1ccccc1CN1C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(Cl)cc3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C33H38ClN3O5/c1-4-41-25-11-6-5-9-21(25)18-37-29(31(39)36-24-10-7-8-19(2)20(24)3)33-17-16-26(42-33)27(28(33)32(37)40)30(38)35-23-14-12-22(34)13-15-23/h5-6,9,11-17,19-20,24,26-29H,4,7-8,10,18H2,1-3H3,(H,35,38)(H,36,39)/t19-,20+,24-,26+,27-,28+,29+,33+/m1/s1 |
| InChIKey | KUDCRRHZXCLAEK-HHQDJIKQSA-N |
| XLogP | 4.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|