C35H43N3O5 — CID 129435534
(1S,2R,5R,6S,7S)-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435534) has the molecular formula C35H43N3O5 and a molecular weight of 585.75 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435534 |
| Molecular Formula | C35H43N3O5 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | (1S,2R,5R,6S,7S)-2-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-6-N-(3,4-dimethylphenyl)-3-[(2-ethoxyphenyl)methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCOc1ccccc1CN1C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(C)c(C)c3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C35H43N3O5/c1-6-42-27-13-8-7-11-24(27)19-38-31(33(40)37-26-12-9-10-21(3)23(26)5)35-17-16-28(43-35)29(30(35)34(38)41)32(39)36-25-15-14-20(2)22(4)18-25/h7-8,11,13-18,21,23,26,28-31H,6,9-10,12,19H2,1-5H3,(H,36,39)(H,37,40)/t21-,23-,26+,28-,29+,30-,31-,35-/m0/s1 |
| InChIKey | GRHIWPXHXUBOON-JJFVZWMRSA-N |
| XLogP | 4.93 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|