C10H9BrF2O2 — CID 99769831
2-bromo-1-[2-(2,2-difluoroethoxy)phenyl]ethanone (PubChem CID 99769831) has the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. Its IUPAC name is 2-bromo-1-[2-(2,2-difluoroethoxy)phenyl]ethanone.
| Compound Name | 2-bromo-1-[2-(2,2-difluoroethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 99769831 |
| Molecular Formula | C10H9BrF2O2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 2-bromo-1-[2-(2,2-difluoroethoxy)phenyl]ethanone |
| SMILES | O=C(CBr)c1ccccc1OCC(F)F |
| InChI | InChI=1S/C10H9BrF2O2/c11-5-8(14)7-3-1-2-4-9(7)15-6-10(12)13/h1-4,10H,5-6H2 |
| InChIKey | ZKGUYPRXFLGXIR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|