About 6-bromo-4-fluoro-1,3-benzoxazole
6-bromo-4-fluoro-1,3-benzoxazole (PubChem CID 99770686) has the molecular formula C7H3BrFNO
and a molecular weight of 216.01 g/mol. Its IUPAC name is 6-bromo-4-fluoro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-bromo-4-fluoro-1,3-benzoxazole |
| PubChem CID | 99770686 |
| Molecular Formula | C7H3BrFNO |
| Molecular Weight | 216.01 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 6-bromo-4-fluoro-1,3-benzoxazole |
| SMILES | Fc1cc(Br)cc2ocnc12 |
| InChI | InChI=1S/C7H3BrFNO/c8-4-1-5(9)7-6(2-4)11-3-10-7/h1-3H |
| InChIKey | WMDPNXKKBGQNLW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.01 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4-fluoro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluoro-1,3-benzoxazole?
The IUPAC name of 6-bromo-4-fluoro-1,3-benzoxazole (CID 99770686) is 6-bromo-4-fluoro-1,3-benzoxazole.
What is the SMILES notation for 6-bromo-4-fluoro-1,3-benzoxazole?
The canonical SMILES for 6-bromo-4-fluoro-1,3-benzoxazole is Fc1cc(Br)cc2ocnc12.
What is the InChIKey of 6-bromo-4-fluoro-1,3-benzoxazole?
The InChIKey is WMDPNXKKBGQNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrFNO/c8-4-1-5(9)7-6(2-4)11-3-10-7/h1-3H.
What are the key properties of 6-bromo-4-fluoro-1,3-benzoxazole?
6-bromo-4-fluoro-1,3-benzoxazole has a molecular weight of 216.01 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluoro-1,3-benzoxazole is sourced from PubChem (CID 99770686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).