C7H2BrF2NO — CID 150284903
7-bromo-4,5-difluoro-1,3-benzoxazole (PubChem CID 150284903) has the molecular formula C7H2BrF2NO and a molecular weight of 234.00 g/mol. Its IUPAC name is 7-bromo-4,5-difluoro-1,3-benzoxazole.
| Compound Name | 7-bromo-4,5-difluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 150284903 |
| Molecular Formula | C7H2BrF2NO |
| Molecular Weight | 234.00 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | 7-bromo-4,5-difluoro-1,3-benzoxazole |
| SMILES | Fc1cc(Br)c2ocnc2c1F |
| InChI | InChI=1S/C7H2BrF2NO/c8-3-1-4(9)5(10)6-7(3)12-2-11-6/h1-2H |
| InChIKey | GGJFHZPSJONBPX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|