C8H7FN2O — CID 167253752
7-fluoro-N-methyl-1,3-benzoxazol-5-amine (PubChem CID 167253752) has the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. Its IUPAC name is 7-fluoro-N-methyl-1,3-benzoxazol-5-amine.
| Compound Name | 7-fluoro-N-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 167253752 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 7-fluoro-N-methyl-1,3-benzoxazol-5-amine |
| SMILES | CNc1cc(F)c2ocnc2c1 |
| InChI | InChI=1S/C8H7FN2O/c1-10-5-2-6(9)8-7(3-5)11-4-12-8/h2-4,10H,1H3 |
| InChIKey | YETNZTRSUZWELB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |