C21H36O2Si — CID 99771745
(3aR,5R,5aS,6R,7R,8aR,8bR)-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-methyl-4,5,5a,6,7,8,8a,8b-octahydro-3aH-as-indacen-3-one (PubChem CID 99771745) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (3aR,5R,5aS,6R,7R,8aR,8bR)-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-methyl-4,5,5a,6,7,8,8a,8b-octahydro-3aH-as-indacen-3-one.
| Compound Name | (3aR,5R,5aS,6R,7R,8aR,8bR)-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-methyl-4,5,5a,6,7,8,8a,8b-octahydro-3aH-as-indacen-3-one |
|---|---|
| PubChem CID | 99771745 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3aR,5R,5aS,6R,7R,8aR,8bR)-5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-methyl-4,5,5a,6,7,8,8a,8b-octahydro-3aH-as-indacen-3-one |
| SMILES | CC[C@H]1[C@H]2[C@H](C[C@H]1C)[C@H]1C=CC(=O)[C@@H]1C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-8-14-13(2)11-17-15-9-10-18(22)16(15)12-19(20(14)17)23-24(6,7)21(3,4)5/h9-10,13-17,19-20H,8,11-12H2,1-7H3/t13-,14-,15+,16-,17-,19-,20+/m1/s1 |
| InChIKey | CKNINXOKQQTTGZ-QYSKAWQBSA-N |
| XLogP | 5.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|