C38H34N2Si2 — CID 99773007
(E)-2-[7-[(Z)-1-cyano-2-[4-(2-trimethylsilylethynyl)phenyl]ethenyl]naphthalen-2-yl]-3-[4-(2-trimethylsilylethynyl)phenyl]prop-2-enenitrile (PubChem CID 99773007) has the molecular formula C38H34N2Si2 and a molecular weight of 574.88 g/mol. Its IUPAC name is (E)-2-[7-[(Z)-1-cyano-2-[4-(2-trimethylsilylethynyl)phenyl]ethenyl]naphthalen-2-yl]-3-[4-(2-trimethylsilylethynyl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-[7-[(Z)-1-cyano-2-[4-(2-trimethylsilylethynyl)phenyl]ethenyl]naphthalen-2-yl]-3-[4-(2-trimethylsilylethynyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 99773007 |
| Molecular Formula | C38H34N2Si2 |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (E)-2-[7-[(Z)-1-cyano-2-[4-(2-trimethylsilylethynyl)phenyl]ethenyl]naphthalen-2-yl]-3-[4-(2-trimethylsilylethynyl)phenyl]prop-2-enenitrile |
| SMILES | C[Si](C)(C)C#Cc1ccc(/C=C(\C#N)c2ccc3ccc(/C(C#N)=C\c4ccc(C#C[Si](C)(C)C)cc4)cc3c2)cc1 |
| InChI | InChI=1S/C38H34N2Si2/c1-41(2,3)21-19-29-7-11-31(12-8-29)23-37(27-39)34-17-15-33-16-18-35(26-36(33)25-34)38(28-40)24-32-13-9-30(10-14-32)20-22-42(4,5)6/h7-18,23-26H,1-6H3/b37-23-,38-24+ |
| InChIKey | UOSQMNGQQAUSRQ-YEITWXIVSA-N |
| XLogP | 9.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|