About diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate
diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate (PubChem CID 99773101) has the molecular formula C9H20BNO2S2
and a molecular weight of 249.21 g/mol. Its IUPAC name is diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate.
Molecular Properties
| Compound Name | diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate |
| PubChem CID | 99773101 |
| Molecular Formula | C9H20BNO2S2 |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate |
| SMILES | CCB(CC)OC(=O)[C@@H](N)CSCSC |
| InChI | InChI=1S/C9H20BNO2S2/c1-4-10(5-2)13-9(12)8(11)6-15-7-14-3/h8H,4-7,11H2,1-3H3/t8-/m0/s1 |
| InChIKey | KHTYDIWVWNKLKJ-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate?
The IUPAC name of diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate (CID 99773101) is diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate.
What is the SMILES notation for diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate?
The canonical SMILES for diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate is CCB(CC)OC(=O)[C@@H](N)CSCSC.
What is the InChIKey of diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate?
The InChIKey is KHTYDIWVWNKLKJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H20BNO2S2/c1-4-10(5-2)13-9(12)8(11)6-15-7-14-3/h8H,4-7,11H2,1-3H3/t8-/m0/s1.
What are the key properties of diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate?
diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate has a molecular weight of 249.21 g/mol, XLogP of 1.94, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethylboranyl (2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoate is sourced from PubChem (CID 99773101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).