About 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride
1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride (PubChem CID 88724618) has the molecular formula C11H25ClN2O2S
and a molecular weight of 284.85 g/mol. Its IUPAC name is 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride |
| PubChem CID | 88724618 |
| Molecular Formula | C11H25ClN2O2S |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride |
| SMILES | CCCCCC(N)OC(=O)[C@@H](N)CSCC.Cl |
| InChI | InChI=1S/C11H24N2O2S.ClH/c1-3-5-6-7-10(13)15-11(14)9(12)8-16-4-2;/h9-10H,3-8,12-13H2,1-2H3;1H/t9-,10?;/m0./s1 |
| InChIKey | QIXWVQJHICLQGI-KKFCBZOWSA-N |
| XLogP | 1.90 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride?
The IUPAC name of 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride (CID 88724618) is 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride.
What is the SMILES notation for 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride?
The canonical SMILES for 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride is CCCCCC(N)OC(=O)[C@@H](N)CSCC.Cl.
What is the InChIKey of 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride?
The InChIKey is QIXWVQJHICLQGI-KKFCBZOWSA-N. The full InChI is InChI=1S/C11H24N2O2S.ClH/c1-3-5-6-7-10(13)15-11(14)9(12)8-16-4-2;/h9-10H,3-8,12-13H2,1-2H3;1H/t9-,10?;/m0./s1.
What are the key properties of 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride?
1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride has a molecular weight of 284.85 g/mol, XLogP of 1.90, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminohexyl (2R)-2-amino-3-ethylsulfanylpropanoate;hydrochloride is sourced from PubChem (CID 88724618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).