C10H20N2O3S2 — CID 88633767
butyl N-[(2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoyl]carbamate (PubChem CID 88633767) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is butyl N-[(2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoyl]carbamate.
| Compound Name | butyl N-[(2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoyl]carbamate |
|---|---|
| PubChem CID | 88633767 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | butyl N-[(2R)-2-amino-3-(methylsulfanylmethylsulfanyl)propanoyl]carbamate |
| SMILES | CCCCOC(=O)NC(=O)[C@@H](N)CSCSC |
| InChI | InChI=1S/C10H20N2O3S2/c1-3-4-5-15-10(14)12-9(13)8(11)6-17-7-16-2/h8H,3-7,11H2,1-2H3,(H,12,13,14)/t8-/m0/s1 |
| InChIKey | MRVPAPJVEGTWTI-QMMMGPOBSA-N |
| XLogP | 1.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|