[(3S)-pyrrolidin-3-yl]boronic acid

C4H10BNO2 — CID 99774592

IUPAC[(3S)-pyrrolidin-3-yl]boronic acid
SMILESOB(O)[C@H]1CCNC1
InChIInChI=1S/C4H10BNO2/c7-5(8)4-1-2-6-3-4/h4,6-8H,1-3H2/t4-/m0/s1
InChIKeyZXXYWZUJUOXWEB-BYPYZUCNSA-N
MW114.94 g/mol
LogP-1.18
Rot. Bonds1

About [(3S)-pyrrolidin-3-yl]boronic acid

[(3S)-pyrrolidin-3-yl]boronic acid (PubChem CID 99774592) has the molecular formula C4H10BNO2 and a molecular weight of 114.94 g/mol. Its IUPAC name is [(3S)-pyrrolidin-3-yl]boronic acid.

Molecular Properties

Compound Name[(3S)-pyrrolidin-3-yl]boronic acid
PubChem CID99774592
Molecular FormulaC4H10BNO2
Molecular Weight114.94 g/mol
Exact Mass115.08
IUPAC Name[(3S)-pyrrolidin-3-yl]boronic acid
SMILESOB(O)[C@H]1CCNC1
InChIInChI=1S/C4H10BNO2/c7-5(8)4-1-2-6-3-4/h4,6-8H,1-3H2/t4-/m0/s1
InChIKeyZXXYWZUJUOXWEB-BYPYZUCNSA-N
XLogP-1.18
TPSA52.49 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.94
LogP ≤ 5-1.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [(3S)-pyrrolidin-3-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3S)-pyrrolidin-3-yl]boronic acid?
The IUPAC name of [(3S)-pyrrolidin-3-yl]boronic acid (CID 99774592) is [(3S)-pyrrolidin-3-yl]boronic acid.
What is the SMILES notation for [(3S)-pyrrolidin-3-yl]boronic acid?
The canonical SMILES for [(3S)-pyrrolidin-3-yl]boronic acid is OB(O)[C@H]1CCNC1.
What is the InChIKey of [(3S)-pyrrolidin-3-yl]boronic acid?
The InChIKey is ZXXYWZUJUOXWEB-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H10BNO2/c7-5(8)4-1-2-6-3-4/h4,6-8H,1-3H2/t4-/m0/s1.
What are the key properties of [(3S)-pyrrolidin-3-yl]boronic acid?
[(3S)-pyrrolidin-3-yl]boronic acid has a molecular weight of 114.94 g/mol, XLogP of -1.18, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-pyrrolidin-3-yl]boronic acid is sourced from PubChem (CID 99774592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).