C16H17F4NO3 — CID 99775306
N-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-2,3,5,6-tetrafluorobenzamide (PubChem CID 99775306) has the molecular formula C16H17F4NO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-2,3,5,6-tetrafluorobenzamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 99775306 |
| Molecular Formula | C16H17F4NO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-2,3,5,6-tetrafluorobenzamide |
| SMILES | O=C(NCC1CCC2(CC1)OCCO2)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H17F4NO3/c17-10-7-11(18)14(20)12(13(10)19)15(22)21-8-9-1-3-16(4-2-9)23-5-6-24-16/h7,9H,1-6,8H2,(H,21,22) |
| InChIKey | QTRFVIBXSYOYMR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|