About 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide
4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide (PubChem CID 99778846) has the molecular formula C14H21NO3S
and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide |
| PubChem CID | 99778846 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N[C@@H]2C[C@H]2CO)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-14(2,3)11-4-6-12(7-5-11)19(17,18)15-13-8-10(13)9-16/h4-7,10,13,15-16H,8-9H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | LFPQZOQUQBTAKR-GXFFZTMASA-N |
| XLogP | 1.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide (CID 99778846) is 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide is CC(C)(C)c1ccc(S(=O)(=O)N[C@@H]2C[C@H]2CO)cc1.
What is the InChIKey of 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide?
The InChIKey is LFPQZOQUQBTAKR-GXFFZTMASA-N. The full InChI is InChI=1S/C14H21NO3S/c1-14(2,3)11-4-6-12(7-5-11)19(17,18)15-13-8-10(13)9-16/h4-7,10,13,15-16H,8-9H2,1-3H3/t10-,13+/m0/s1.
What are the key properties of 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide?
4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide has a molecular weight of 283.39 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]benzenesulfonamide is sourced from PubChem (CID 99778846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).