C10H10BrClN2O2S — CID 99779243
(3R,8aR)-3-(4-bromo-5-chlorothiophen-2-yl)-2,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]oxazin-1-one (PubChem CID 99779243) has the molecular formula C10H10BrClN2O2S and a molecular weight of 337.63 g/mol. Its IUPAC name is (3R,8aR)-3-(4-bromo-5-chlorothiophen-2-yl)-2,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]oxazin-1-one.
| Compound Name | (3R,8aR)-3-(4-bromo-5-chlorothiophen-2-yl)-2,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 99779243 |
| Molecular Formula | C10H10BrClN2O2S |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | (3R,8aR)-3-(4-bromo-5-chlorothiophen-2-yl)-2,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]oxazin-1-one |
| SMILES | O=C1N[C@@H](c2cc(Br)c(Cl)s2)N2CCOC[C@H]12 |
| InChI | InChI=1S/C10H10BrClN2O2S/c11-5-3-7(17-8(5)12)9-13-10(15)6-4-16-2-1-14(6)9/h3,6,9H,1-2,4H2,(H,13,15)/t6-,9-/m1/s1 |
| InChIKey | CUSMBEVNKNOTHX-HZGVNTEJSA-N |
| XLogP | 1.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |