C19H31NO4 — CID 99781125
tert-butyl (2R)-2-[[4-(2-methoxyethoxy)phenyl]methylamino]-3-methylbutanoate (PubChem CID 99781125) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-(2-methoxyethoxy)phenyl]methylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[[4-(2-methoxyethoxy)phenyl]methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 99781125 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl (2R)-2-[[4-(2-methoxyethoxy)phenyl]methylamino]-3-methylbutanoate |
| SMILES | COCCOc1ccc(CN[C@@H](C(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H31NO4/c1-14(2)17(18(21)24-19(3,4)5)20-13-15-7-9-16(10-8-15)23-12-11-22-6/h7-10,14,17,20H,11-13H2,1-6H3/t17-/m1/s1 |
| InChIKey | MUGBGSGWLPXREP-QGZVFWFLSA-N |
| XLogP | 3.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|