C17H20FN3O3 — CID 99781228
(2S)-2-[[1-(2-fluorophenyl)pyrazole-4-carbonyl]amino]heptanoic acid (PubChem CID 99781228) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is (2S)-2-[[1-(2-fluorophenyl)pyrazole-4-carbonyl]amino]heptanoic acid.
| Compound Name | (2S)-2-[[1-(2-fluorophenyl)pyrazole-4-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 99781228 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2S)-2-[[1-(2-fluorophenyl)pyrazole-4-carbonyl]amino]heptanoic acid |
| SMILES | CCCCC[C@H](NC(=O)c1cnn(-c2ccccc2F)c1)C(=O)O |
| InChI | InChI=1S/C17H20FN3O3/c1-2-3-4-8-14(17(23)24)20-16(22)12-10-19-21(11-12)15-9-6-5-7-13(15)18/h5-7,9-11,14H,2-4,8H2,1H3,(H,20,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | PMLCDMQPJMXZNQ-AWEZNQCLSA-N |
| XLogP | 2.77 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|