C15H17F3N4O — CID 99783372
N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(2,4,5-trifluorophenyl)acetamide (PubChem CID 99783372) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(2,4,5-trifluorophenyl)acetamide.
| Compound Name | N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(2,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 99783372 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(2,4,5-trifluorophenyl)acetamide |
| SMILES | CC(C)c1nnc(CNC(=O)Cc2cc(F)c(F)cc2F)n1C |
| InChI | InChI=1S/C15H17F3N4O/c1-8(2)15-21-20-13(22(15)3)7-19-14(23)5-9-4-11(17)12(18)6-10(9)16/h4,6,8H,5,7H2,1-3H3,(H,19,23) |
| InChIKey | WODDNTVONWWAFN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|