C12H23F3N2O — CID 99784562
(2R)-1-(dimethylamino)-3-[[4-(trifluoromethyl)cyclohexyl]amino]propan-2-ol (PubChem CID 99784562) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is (2R)-1-(dimethylamino)-3-[[4-(trifluoromethyl)cyclohexyl]amino]propan-2-ol.
| Compound Name | (2R)-1-(dimethylamino)-3-[[4-(trifluoromethyl)cyclohexyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 99784562 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2R)-1-(dimethylamino)-3-[[4-(trifluoromethyl)cyclohexyl]amino]propan-2-ol |
| SMILES | CN(C)C[C@H](O)CNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N2O/c1-17(2)8-11(18)7-16-10-5-3-9(4-6-10)12(13,14)15/h9-11,16,18H,3-8H2,1-2H3/t9?,10?,11-/m1/s1 |
| InChIKey | DJRHRTWRGWGHTB-VQXHTEKXSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |