C25H24N4O3 — CID 99786282
N-[3-[(3S)-3-(benzimidazol-1-ylmethyl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide (PubChem CID 99786282) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[3-[(3S)-3-(benzimidazol-1-ylmethyl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(3S)-3-(benzimidazol-1-ylmethyl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 99786282 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[3-[(3S)-3-(benzimidazol-1-ylmethyl)piperidine-1-carbonyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC[C@@H](Cn3cnc4ccccc43)C2)c1)c1ccco1 |
| InChI | InChI=1S/C25H24N4O3/c30-24(23-11-5-13-32-23)27-20-8-3-7-19(14-20)25(31)28-12-4-6-18(15-28)16-29-17-26-21-9-1-2-10-22(21)29/h1-3,5,7-11,13-14,17-18H,4,6,12,15-16H2,(H,27,30)/t18-/m1/s1 |
| InChIKey | GCCOYLKUUANYKM-GOSISDBHSA-N |
| XLogP | 4.43 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |