C24H24N4O — CID 99797712
1-[(3S)-3-(benzimidazol-1-ylmethyl)piperidin-1-yl]-2-quinolin-3-ylethanone (PubChem CID 99797712) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[(3S)-3-(benzimidazol-1-ylmethyl)piperidin-1-yl]-2-quinolin-3-ylethanone.
| Compound Name | 1-[(3S)-3-(benzimidazol-1-ylmethyl)piperidin-1-yl]-2-quinolin-3-ylethanone |
|---|---|
| PubChem CID | 99797712 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[(3S)-3-(benzimidazol-1-ylmethyl)piperidin-1-yl]-2-quinolin-3-ylethanone |
| SMILES | O=C(Cc1cnc2ccccc2c1)N1CCC[C@@H](Cn2cnc3ccccc32)C1 |
| InChI | InChI=1S/C24H24N4O/c29-24(13-19-12-20-7-1-2-8-21(20)25-14-19)27-11-5-6-18(15-27)16-28-17-26-22-9-3-4-10-23(22)28/h1-4,7-10,12,14,17-18H,5-6,11,13,15-16H2/t18-/m1/s1 |
| InChIKey | FEROUSGXRBIAIT-GOSISDBHSA-N |
| XLogP | 4.07 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |