C19H25N3O3 — CID 99788804
(2R)-2-[(8aS)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl]-N,N-diethyl-2-phenylacetamide (PubChem CID 99788804) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R)-2-[(8aS)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl]-N,N-diethyl-2-phenylacetamide.
| Compound Name | (2R)-2-[(8aS)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl]-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 99788804 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2R)-2-[(8aS)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl]-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)[C@@H](c1ccccc1)N1C(=O)[C@@H]2CCCCN2C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-3-20(4-2)18(24)16(14-10-6-5-7-11-14)22-17(23)15-12-8-9-13-21(15)19(22)25/h5-7,10-11,15-16H,3-4,8-9,12-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | WAEBLMXDXYGHMZ-JKSUJKDBSA-N |
| XLogP | 2.41 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|