C17H22BrNO3 — CID 99791914
(2S)-2-[(3R)-4-[(2-bromo-5-methoxyphenyl)methyl]morpholin-3-yl]cyclopentan-1-one (PubChem CID 99791914) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is (2S)-2-[(3R)-4-[(2-bromo-5-methoxyphenyl)methyl]morpholin-3-yl]cyclopentan-1-one.
| Compound Name | (2S)-2-[(3R)-4-[(2-bromo-5-methoxyphenyl)methyl]morpholin-3-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 99791914 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2S)-2-[(3R)-4-[(2-bromo-5-methoxyphenyl)methyl]morpholin-3-yl]cyclopentan-1-one |
| SMILES | COc1ccc(Br)c(CN2CCOC[C@H]2[C@@H]2CCCC2=O)c1 |
| InChI | InChI=1S/C17H22BrNO3/c1-21-13-5-6-15(18)12(9-13)10-19-7-8-22-11-16(19)14-3-2-4-17(14)20/h5-6,9,14,16H,2-4,7-8,10-11H2,1H3/t14-,16-/m0/s1 |
| InChIKey | ZDYRXZHINULUPA-HOCLYGCPSA-N |
| XLogP | 3.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |