C14H15BrN2O3 — CID 99791992
[4-[(5-bromofuran-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 99791992) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is [4-[(5-bromofuran-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[(5-bromofuran-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 99791992 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [4-[(5-bromofuran-2-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCN(Cc2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-13-2-1-12(20-13)9-16-4-6-17(7-5-16)14(18)11-3-8-19-10-11/h1-3,8,10H,4-7,9H2 |
| InChIKey | LQGHTHVHTHOVBW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |