C18H26N4O2 — CID 75471888
[4-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 75471888) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is [4-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 75471888 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | [4-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | Cn1cc(CN2CCN(C(=O)c3ccoc3)CC2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H26N4O2/c1-18(2,3)16-15(11-20(4)19-16)12-21-6-8-22(9-7-21)17(23)14-5-10-24-13-14/h5,10-11,13H,6-9,12H2,1-4H3 |
| InChIKey | OFFNXDJAUGSCNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |