C17H31N3O3 — CID 99792568
N',N'-diethyl-N-[(2S)-2-(2-oxopiperidin-1-yl)propyl]pentanediamide (PubChem CID 99792568) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is N',N'-diethyl-N-[(2S)-2-(2-oxopiperidin-1-yl)propyl]pentanediamide.
| Compound Name | N',N'-diethyl-N-[(2S)-2-(2-oxopiperidin-1-yl)propyl]pentanediamide |
|---|---|
| PubChem CID | 99792568 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N',N'-diethyl-N-[(2S)-2-(2-oxopiperidin-1-yl)propyl]pentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)NC[C@H](C)N1CCCCC1=O |
| InChI | InChI=1S/C17H31N3O3/c1-4-19(5-2)16(22)11-8-9-15(21)18-13-14(3)20-12-7-6-10-17(20)23/h14H,4-13H2,1-3H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | GSPQKSMFMKMFHY-AWEZNQCLSA-N |
| XLogP | 1.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |