C20H18N6OS — CID 99794593
5-phenyl-3-[(1S)-1-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,2,4-oxadiazole (PubChem CID 99794593) has the molecular formula C20H18N6OS and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-phenyl-3-[(1S)-1-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 5-phenyl-3-[(1S)-1-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99794593 |
| Molecular Formula | C20H18N6OS |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-phenyl-3-[(1S)-1-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,2,4-oxadiazole |
| SMILES | C=CCn1c(S[C@@H](C)c2noc(-c3ccccc3)n2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H18N6OS/c1-3-13-26-18(15-9-11-21-12-10-15)23-24-20(26)28-14(2)17-22-19(27-25-17)16-7-5-4-6-8-16/h3-12,14H,1,13H2,2H3/t14-/m0/s1 |
| InChIKey | LECSTDVHCRUAOZ-AWEZNQCLSA-N |
| XLogP | 4.43 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|