C17H24BrNO3S — CID 99795370
methyl 2-[3-[[(2R)-2-(4-bromophenyl)-3-methylbutan-2-yl]amino]-3-oxopropyl]sulfanylacetate (PubChem CID 99795370) has the molecular formula C17H24BrNO3S and a molecular weight of 402.35 g/mol. Its IUPAC name is methyl 2-[3-[[(2R)-2-(4-bromophenyl)-3-methylbutan-2-yl]amino]-3-oxopropyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[[(2R)-2-(4-bromophenyl)-3-methylbutan-2-yl]amino]-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 99795370 |
| Molecular Formula | C17H24BrNO3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | methyl 2-[3-[[(2R)-2-(4-bromophenyl)-3-methylbutan-2-yl]amino]-3-oxopropyl]sulfanylacetate |
| SMILES | COC(=O)CSCCC(=O)N[C@@](C)(c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C17H24BrNO3S/c1-12(2)17(3,13-5-7-14(18)8-6-13)19-15(20)9-10-23-11-16(21)22-4/h5-8,12H,9-11H2,1-4H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | GLGGZVWRQYZSKT-QGZVFWFLSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|