C14H18N2O3 — CID 99795385
methyl (2S)-2-[cyclobutyl(pyridine-4-carbonyl)amino]propanoate (PubChem CID 99795385) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl (2S)-2-[cyclobutyl(pyridine-4-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[cyclobutyl(pyridine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 99795385 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | methyl (2S)-2-[cyclobutyl(pyridine-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)c1ccncc1)C1CCC1 |
| InChI | InChI=1S/C14H18N2O3/c1-10(14(18)19-2)16(12-4-3-5-12)13(17)11-6-8-15-9-7-11/h6-10,12H,3-5H2,1-2H3/t10-/m0/s1 |
| InChIKey | OOXWWGCJUZBWAU-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |