C13H22N2O5 — CID 99799557
(5R)-5-(methoxymethyl)-5-methyl-3-[2-[(2S)-oxan-2-yl]oxyethyl]imidazolidine-2,4-dione (PubChem CID 99799557) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is (5R)-5-(methoxymethyl)-5-methyl-3-[2-[(2S)-oxan-2-yl]oxyethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(methoxymethyl)-5-methyl-3-[2-[(2S)-oxan-2-yl]oxyethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99799557 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (5R)-5-(methoxymethyl)-5-methyl-3-[2-[(2S)-oxan-2-yl]oxyethyl]imidazolidine-2,4-dione |
| SMILES | COC[C@@]1(C)NC(=O)N(CCO[C@H]2CCCCO2)C1=O |
| InChI | InChI=1S/C13H22N2O5/c1-13(9-18-2)11(16)15(12(17)14-13)6-8-20-10-5-3-4-7-19-10/h10H,3-9H2,1-2H3,(H,14,17)/t10-,13+/m0/s1 |
| InChIKey | RIEFIKKHKJCIHR-GXFFZTMASA-N |
| XLogP | 0.49 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|