C13H20N2O3 — CID 99799558
3,4-dimethyl-6-[2-[(2R)-oxan-2-yl]oxyethoxy]pyridazine (PubChem CID 99799558) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,4-dimethyl-6-[2-[(2R)-oxan-2-yl]oxyethoxy]pyridazine.
| Compound Name | 3,4-dimethyl-6-[2-[(2R)-oxan-2-yl]oxyethoxy]pyridazine |
|---|---|
| PubChem CID | 99799558 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3,4-dimethyl-6-[2-[(2R)-oxan-2-yl]oxyethoxy]pyridazine |
| SMILES | Cc1cc(OCCO[C@@H]2CCCCO2)nnc1C |
| InChI | InChI=1S/C13H20N2O3/c1-10-9-12(15-14-11(10)2)16-7-8-18-13-5-3-4-6-17-13/h9,13H,3-8H2,1-2H3/t13-/m1/s1 |
| InChIKey | AXCBXAIGNKVWDO-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|